C19H12ClN3NiO2 — CID 23631665
5-chloro-2-[[2-[(2-oxidophenyl)methylideneamino]phenyl]diazenyl]phenolate;nickel(2+) (PubChem CID 23631665) has the molecular formula C19H12ClN3NiO2 and a molecular weight of 408.47 g/mol. Its IUPAC name is 5-chloro-2-[[2-[(2-oxidophenyl)methylideneamino]phenyl]diazenyl]phenolate;nickel(2+).
| Compound Name | 5-chloro-2-[[2-[(2-oxidophenyl)methylideneamino]phenyl]diazenyl]phenolate;nickel(2+) |
|---|---|
| PubChem CID | 23631665 |
| Molecular Formula | C19H12ClN3NiO2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | 5-chloro-2-[[2-[(2-oxidophenyl)methylideneamino]phenyl]diazenyl]phenolate;nickel(2+) |
| SMILES | [Ni+2].[O-]c1ccccc1/C=N/c1ccccc1/N=N/c1ccc(Cl)cc1[O-] |
| InChI | InChI=1S/C19H14ClN3O2.Ni/c20-14-9-10-17(19(25)11-14)23-22-16-7-3-2-6-15(16)21-12-13-5-1-4-8-18(13)24;/h1-12,24-25H;/q;+2/p-2/b21-12+,23-22+; |
| InChIKey | RCXQVKIGLYOZOL-BFLXDSMBSA-L |
| XLogP | 4.65 |
| TPSA | 83.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|