C19H16N2O3Pt — CID 10186083
2-[(2-oxidophenyl)iminomethyl]phenolate;platinum(2+);pyridin-4-ylmethanol (PubChem CID 10186083) has the molecular formula C19H16N2O3Pt and a molecular weight of 515.43 g/mol. Its IUPAC name is 2-[(2-oxidophenyl)iminomethyl]phenolate;platinum(2+);pyridin-4-ylmethanol.
| Compound Name | 2-[(2-oxidophenyl)iminomethyl]phenolate;platinum(2+);pyridin-4-ylmethanol |
|---|---|
| PubChem CID | 10186083 |
| Molecular Formula | C19H16N2O3Pt |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | 2-[(2-oxidophenyl)iminomethyl]phenolate;platinum(2+);pyridin-4-ylmethanol |
| SMILES | OCc1ccncc1.[O-]c1ccccc1/C=N/c1ccccc1[O-].[Pt+2] |
| InChI | InChI=1S/C13H11NO2.C6H7NO.Pt/c15-12-7-3-1-5-10(12)9-14-11-6-2-4-8-13(11)16;8-5-6-1-3-7-4-2-6;/h1-9,15-16H;1-4,8H,5H2;/q;;+2/p-2/b14-9+;; |
| InChIKey | LDPJYXPSIYWECN-CAJRCRMVSA-L |
| XLogP | 2.16 |
| TPSA | 91.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|