C14H12BrNO2 — CID 137224260
2-[(2-bromophenyl)iminomethyl]-5-methoxyphenol (PubChem CID 137224260) has the molecular formula C14H12BrNO2 and a molecular weight of 306.16 g/mol. Its IUPAC name is 2-[(2-bromophenyl)iminomethyl]-5-methoxyphenol.
| Compound Name | 2-[(2-bromophenyl)iminomethyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 137224260 |
| Molecular Formula | C14H12BrNO2 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 2-[(2-bromophenyl)iminomethyl]-5-methoxyphenol |
| SMILES | COc1ccc(/C=N/c2ccccc2Br)c(O)c1 |
| InChI | InChI=1S/C14H12BrNO2/c1-18-11-7-6-10(14(17)8-11)9-16-13-5-3-2-4-12(13)15/h2-9,17H,1H3/b16-9+ |
| InChIKey | JKLNUZQOPJAFBE-CXUHLZMHSA-N |
| XLogP | 3.91 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|