C16H19NO4 — CID 135578361
4-[(2-hydroxyphenyl)iminomethyl]benzene-1,3-diol;propan-2-ol (PubChem CID 135578361) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-[(2-hydroxyphenyl)iminomethyl]benzene-1,3-diol;propan-2-ol.
| Compound Name | 4-[(2-hydroxyphenyl)iminomethyl]benzene-1,3-diol;propan-2-ol |
|---|---|
| PubChem CID | 135578361 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-[(2-hydroxyphenyl)iminomethyl]benzene-1,3-diol;propan-2-ol |
| SMILES | CC(C)O.Oc1ccc(/C=N/c2ccccc2O)c(O)c1 |
| InChI | InChI=1S/C13H11NO3.C3H8O/c15-10-6-5-9(13(17)7-10)8-14-11-3-1-2-4-12(11)16;1-3(2)4/h1-8,15-17H;3-4H,1-2H3/b14-8+; |
| InChIKey | GXQXAXKHASWFMD-XHIXCECLSA-N |
| XLogP | 2.94 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|