C21H19NO3 — CID 136694888
4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]iminomethyl]benzene-1,3-diol (PubChem CID 136694888) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]iminomethyl]benzene-1,3-diol.
| Compound Name | 4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136694888 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]iminomethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/C=N/[C@H](c2ccccc2)[C@@H](O)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C21H19NO3/c23-18-12-11-17(19(24)13-18)14-22-20(15-7-3-1-4-8-15)21(25)16-9-5-2-6-10-16/h1-14,20-21,23-25H/b22-14+/t20-,21+/m1/s1 |
| InChIKey | HJSUJCNFSJWLJG-WHOFGVDJSA-N |
| XLogP | 3.99 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|