C44H54N4O4 — CID 137124069
2-[[(1R,2S)-2-[[2-hydroxy-4-(3-piperidin-1-ylpropoxy)phenyl]methylideneamino]-1,2-diphenylethyl]iminomethyl]-5-(3-piperidin-1-ylpropoxy)phenol (PubChem CID 137124069) has the molecular formula C44H54N4O4 and a molecular weight of 702.94 g/mol. Its IUPAC name is 2-[[(1R,2S)-2-[[2-hydroxy-4-(3-piperidin-1-ylpropoxy)phenyl]methylideneamino]-1,2-diphenylethyl]iminomethyl]-5-(3-piperidin-1-ylpropoxy)phenol.
| Compound Name | 2-[[(1R,2S)-2-[[2-hydroxy-4-(3-piperidin-1-ylpropoxy)phenyl]methylideneamino]-1,2-diphenylethyl]iminomethyl]-5-(3-piperidin-1-ylpropoxy)phenol |
|---|---|
| PubChem CID | 137124069 |
| Molecular Formula | C44H54N4O4 |
| Molecular Weight | 702.94 g/mol |
| Exact Mass | 702.41 |
| IUPAC Name | 2-[[(1R,2S)-2-[[2-hydroxy-4-(3-piperidin-1-ylpropoxy)phenyl]methylideneamino]-1,2-diphenylethyl]iminomethyl]-5-(3-piperidin-1-ylpropoxy)phenol |
| SMILES | Oc1cc(OCCCN2CCCCC2)ccc1/C=N/[C@H](c1ccccc1)[C@@H](/N=C/c1ccc(OCCCN2CCCCC2)cc1O)c1ccccc1 |
| InChI | InChI=1S/C44H54N4O4/c49-41-31-39(51-29-13-27-47-23-9-3-10-24-47)21-19-37(41)33-45-43(35-15-5-1-6-16-35)44(36-17-7-2-8-18-36)46-34-38-20-22-40(32-42(38)50)52-30-14-28-48-25-11-4-12-26-48/h1-2,5-8,15-22,31-34,43-44,49-50H,3-4,9-14,23-30H2/b45-33+,46-34+/t43-,44+ |
| InChIKey | RKTFRMHHHHVKEL-ACBLRROESA-N |
| XLogP | 8.63 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.94 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|