C20H23MnN2O6 — CID 44599371
manganese(3+);5-methoxy-2-[2-[[(Z)-(4-methoxy-6-oxidocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethyliminomethyl]phenolate;acetate (PubChem CID 44599371) has the molecular formula C20H23MnN2O6 and a molecular weight of 442.35 g/mol. Its IUPAC name is manganese(3+);5-methoxy-2-[2-[[(Z)-(4-methoxy-6-oxidocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethyliminomethyl]phenolate;acetate.
| Compound Name | manganese(3+);5-methoxy-2-[2-[[(Z)-(4-methoxy-6-oxidocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethyliminomethyl]phenolate;acetate |
|---|---|
| PubChem CID | 44599371 |
| Molecular Formula | C20H23MnN2O6 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | manganese(3+);5-methoxy-2-[2-[[(Z)-(4-methoxy-6-oxidocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethyliminomethyl]phenolate;acetate |
| SMILES | CC(=O)[O-].COC1=CC([O-])/C(=C\NCC/N=C/c2ccc(OC)cc2[O-])C=C1.[Mn+3] |
| InChI | InChI=1S/C18H21N2O4.C2H4O2.Mn/c1-23-15-5-3-13(17(21)9-15)11-19-7-8-20-12-14-4-6-16(24-2)10-18(14)22;1-2(3)4;/h3-6,9-12,17,19,22H,7-8H2,1-2H3;1H3,(H,3,4);/q-1;;+3/p-2/b13-11-,20-12+;; |
| InChIKey | KJTSECXBSBVYEC-VUFRAYRKSA-L |
| XLogP | -0.76 |
| TPSA | 129.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|