C24H17Cl2O2P — CID 177496549
2,4-dichloro-6-(2-diphenylphosphorylphenyl)phenol (PubChem CID 177496549) has the molecular formula C24H17Cl2O2P and a molecular weight of 439.28 g/mol. Its IUPAC name is 2,4-dichloro-6-(2-diphenylphosphorylphenyl)phenol.
| Compound Name | 2,4-dichloro-6-(2-diphenylphosphorylphenyl)phenol |
|---|---|
| PubChem CID | 177496549 |
| Molecular Formula | C24H17Cl2O2P |
| Molecular Weight | 439.28 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 2,4-dichloro-6-(2-diphenylphosphorylphenyl)phenol |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccccc1-c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C24H17Cl2O2P/c25-17-15-21(24(27)22(26)16-17)20-13-7-8-14-23(20)29(28,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-16,27H |
| InChIKey | YOQYRHHDBOZQOZ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.28 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|