About 4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole
4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole (PubChem CID 174756251) has the molecular formula C15H12ClNS
and a molecular weight of 273.79 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole |
| PubChem CID | 174756251 |
| Molecular Formula | C15H12ClNS |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole |
| SMILES | Cc1nc2c(-c3ccc(Cl)cc3)c(C)ccc2s1 |
| InChI | InChI=1S/C15H12ClNS/c1-9-3-8-13-15(17-10(2)18-13)14(9)11-4-6-12(16)7-5-11/h3-8H,1-2H3 |
| InChIKey | CQLKGICQOFJZSI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole?
The IUPAC name of 4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole (CID 174756251) is 4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole.
What is the SMILES notation for 4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole?
The canonical SMILES for 4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole is Cc1nc2c(-c3ccc(Cl)cc3)c(C)ccc2s1.
What is the InChIKey of 4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole?
The InChIKey is CQLKGICQOFJZSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClNS/c1-9-3-8-13-15(17-10(2)18-13)14(9)11-4-6-12(16)7-5-11/h3-8H,1-2H3.
What are the key properties of 4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole?
4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole has a molecular weight of 273.79 g/mol, XLogP of 5.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-2,5-dimethyl-1,3-benzothiazole is sourced from PubChem (CID 174756251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).