(2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid

C9H10BNO2S — CID 174110832

IUPAC(2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid
SMILESCc1nc2c(B(O)O)c(C)ccc2s1
InChIInChI=1S/C9H10BNO2S/c1-5-3-4-7-9(8(5)10(12)13)11-6(2)14-7/h3-4,12-13H,1-2H3
InChIKeyGZVRIAGSRVVIHW-UHFFFAOYSA-N
MW207.06 g/mol
LogP0.59
Rot. Bonds1

About (2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid

(2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid (PubChem CID 174110832) has the molecular formula C9H10BNO2S and a molecular weight of 207.06 g/mol. Its IUPAC name is (2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid.

Molecular Properties

Compound Name(2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid
PubChem CID174110832
Molecular FormulaC9H10BNO2S
Molecular Weight207.06 g/mol
Exact Mass207.05
IUPAC Name(2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid
SMILESCc1nc2c(B(O)O)c(C)ccc2s1
InChIInChI=1S/C9H10BNO2S/c1-5-3-4-7-9(8(5)10(12)13)11-6(2)14-7/h3-4,12-13H,1-2H3
InChIKeyGZVRIAGSRVVIHW-UHFFFAOYSA-N
XLogP0.59
TPSA53.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.06
LogP ≤ 50.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid?
The IUPAC name of (2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid (CID 174110832) is (2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid.
What is the SMILES notation for (2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid?
The canonical SMILES for (2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid is Cc1nc2c(B(O)O)c(C)ccc2s1.
What is the InChIKey of (2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid?
The InChIKey is GZVRIAGSRVVIHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BNO2S/c1-5-3-4-7-9(8(5)10(12)13)11-6(2)14-7/h3-4,12-13H,1-2H3.
What are the key properties of (2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid?
(2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid has a molecular weight of 207.06 g/mol, XLogP of 0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid is sourced from PubChem (CID 174110832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).