C9H10BNO2S — CID 174110832
(2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid (PubChem CID 174110832) has the molecular formula C9H10BNO2S and a molecular weight of 207.06 g/mol. Its IUPAC name is (2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid.
| Compound Name | (2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid |
|---|---|
| PubChem CID | 174110832 |
| Molecular Formula | C9H10BNO2S |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | (2,5-dimethyl-1,3-benzothiazol-4-yl)boronic acid |
| SMILES | Cc1nc2c(B(O)O)c(C)ccc2s1 |
| InChI | InChI=1S/C9H10BNO2S/c1-5-3-4-7-9(8(5)10(12)13)11-6(2)14-7/h3-4,12-13H,1-2H3 |
| InChIKey | GZVRIAGSRVVIHW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|