About 2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole
2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole (PubChem CID 135130168) has the molecular formula C14H19NS
and a molecular weight of 233.38 g/mol. Its IUPAC name is 2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole |
| PubChem CID | 135130168 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole |
| SMILES | Cc1nc2c(C(C)C)c(C(C)C)ccc2s1 |
| InChI | InChI=1S/C14H19NS/c1-8(2)11-6-7-12-14(13(11)9(3)4)15-10(5)16-12/h6-9H,1-5H3 |
| InChIKey | XJWOECUSSONNTD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole?
The IUPAC name of 2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole (CID 135130168) is 2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole.
What is the SMILES notation for 2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole?
The canonical SMILES for 2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole is Cc1nc2c(C(C)C)c(C(C)C)ccc2s1.
What is the InChIKey of 2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole?
The InChIKey is XJWOECUSSONNTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NS/c1-8(2)11-6-7-12-14(13(11)9(3)4)15-10(5)16-12/h6-9H,1-5H3.
What are the key properties of 2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole?
2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole has a molecular weight of 233.38 g/mol, XLogP of 4.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5-di(propan-2-yl)-1,3-benzothiazole is sourced from PubChem (CID 135130168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).