C13H17NS — CID 118099941
4,5-di(propan-2-yl)-1,2-benzothiazole (PubChem CID 118099941) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is 4,5-di(propan-2-yl)-1,2-benzothiazole.
| Compound Name | 4,5-di(propan-2-yl)-1,2-benzothiazole |
|---|---|
| PubChem CID | 118099941 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 4,5-di(propan-2-yl)-1,2-benzothiazole |
| SMILES | CC(C)c1ccc2sncc2c1C(C)C |
| InChI | InChI=1S/C13H17NS/c1-8(2)10-5-6-12-11(7-14-15-12)13(10)9(3)4/h5-9H,1-4H3 |
| InChIKey | ABVHVJAFVPRBLN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |