C13H18N2OS2 — CID 141102835
4,5-di(propan-2-yl)-1,3-benzothiazole-2-sulfinamide (PubChem CID 141102835) has the molecular formula C13H18N2OS2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 4,5-di(propan-2-yl)-1,3-benzothiazole-2-sulfinamide.
| Compound Name | 4,5-di(propan-2-yl)-1,3-benzothiazole-2-sulfinamide |
|---|---|
| PubChem CID | 141102835 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4,5-di(propan-2-yl)-1,3-benzothiazole-2-sulfinamide |
| SMILES | CC(C)c1ccc2sc(S(N)=O)nc2c1C(C)C |
| InChI | InChI=1S/C13H18N2OS2/c1-7(2)9-5-6-10-12(11(9)8(3)4)15-13(17-10)18(14)16/h5-8H,14H2,1-4H3 |
| InChIKey | OFRCKVRPMXHCMW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |