C10H12N2OS2 — CID 61367097
2-propan-2-ylsulfinyl-1,3-benzothiazol-6-amine (PubChem CID 61367097) has the molecular formula C10H12N2OS2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-propan-2-ylsulfinyl-1,3-benzothiazol-6-amine.
| Compound Name | 2-propan-2-ylsulfinyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 61367097 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-propan-2-ylsulfinyl-1,3-benzothiazol-6-amine |
| SMILES | CC(C)S(=O)c1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C10H12N2OS2/c1-6(2)15(13)10-12-8-4-3-7(11)5-9(8)14-10/h3-6H,11H2,1-2H3 |
| InChIKey | PYJHAICBOJRLBN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|