C10H9F3N2OS2 — CID 64567997
2-(3,3,3-trifluoropropylsulfinyl)-1,3-benzothiazol-6-amine (PubChem CID 64567997) has the molecular formula C10H9F3N2OS2 and a molecular weight of 294.32 g/mol. Its IUPAC name is 2-(3,3,3-trifluoropropylsulfinyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(3,3,3-trifluoropropylsulfinyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 64567997 |
| Molecular Formula | C10H9F3N2OS2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 2-(3,3,3-trifluoropropylsulfinyl)-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(S(=O)CCC(F)(F)F)sc2c1 |
| InChI | InChI=1S/C10H9F3N2OS2/c11-10(12,13)3-4-18(16)9-15-7-2-1-6(14)5-8(7)17-9/h1-2,5H,3-4,14H2 |
| InChIKey | KYFCVQFMHPPRAA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|