C11H11F3N2O2S2 — CID 115517934
2-(4,4,4-trifluorobutylsulfonyl)-1,3-benzothiazol-6-amine (PubChem CID 115517934) has the molecular formula C11H11F3N2O2S2 and a molecular weight of 324.35 g/mol. Its IUPAC name is 2-(4,4,4-trifluorobutylsulfonyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(4,4,4-trifluorobutylsulfonyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 115517934 |
| Molecular Formula | C11H11F3N2O2S2 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 2-(4,4,4-trifluorobutylsulfonyl)-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(S(=O)(=O)CCCC(F)(F)F)sc2c1 |
| InChI | InChI=1S/C11H11F3N2O2S2/c12-11(13,14)4-1-5-20(17,18)10-16-8-3-2-7(15)6-9(8)19-10/h2-3,6H,1,4-5,15H2 |
| InChIKey | CBPPXYDSBXOQBP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|