C13H17N3O3S2 — CID 61367807
2-[(6-amino-1,3-benzothiazol-2-yl)sulfonyl]-N-methyl-N-propan-2-ylacetamide (PubChem CID 61367807) has the molecular formula C13H17N3O3S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzothiazol-2-yl)sulfonyl]-N-methyl-N-propan-2-ylacetamide.
| Compound Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfonyl]-N-methyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 61367807 |
| Molecular Formula | C13H17N3O3S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfonyl]-N-methyl-N-propan-2-ylacetamide |
| SMILES | CC(C)N(C)C(=O)CS(=O)(=O)c1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C13H17N3O3S2/c1-8(2)16(3)12(17)7-21(18,19)13-15-10-5-4-9(14)6-11(10)20-13/h4-6,8H,7,14H2,1-3H3 |
| InChIKey | LKEODVDXMXUWTJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|