C8H5F3N2O2S2 — CID 61369334
2-(trifluoromethylsulfonyl)-1,3-benzothiazol-6-amine (PubChem CID 61369334) has the molecular formula C8H5F3N2O2S2 and a molecular weight of 282.27 g/mol. Its IUPAC name is 2-(trifluoromethylsulfonyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(trifluoromethylsulfonyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 61369334 |
| Molecular Formula | C8H5F3N2O2S2 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | 2-(trifluoromethylsulfonyl)-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(S(=O)(=O)C(F)(F)F)sc2c1 |
| InChI | InChI=1S/C8H5F3N2O2S2/c9-8(10,11)17(14,15)7-13-5-2-1-4(12)3-6(5)16-7/h1-3H,12H2 |
| InChIKey | FIKCUZAWNRSJMM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|