C8H9N5S — CID 130005649
2-(6-amino-1,3-benzothiazol-2-yl)guanidine (PubChem CID 130005649) has the molecular formula C8H9N5S and a molecular weight of 207.26 g/mol. Its IUPAC name is 2-(6-amino-1,3-benzothiazol-2-yl)guanidine.
| Compound Name | 2-(6-amino-1,3-benzothiazol-2-yl)guanidine |
|---|---|
| PubChem CID | 130005649 |
| Molecular Formula | C8H9N5S |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2-(6-amino-1,3-benzothiazol-2-yl)guanidine |
| SMILES | NC(N)=Nc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C8H9N5S/c9-4-1-2-5-6(3-4)14-8(12-5)13-7(10)11/h1-3H,9H2,(H4,10,11,12,13) |
| InChIKey | XOAWSKFZCKZZLE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|