C9H5Cl4N3S — CID 174165572
2,2,2-trichloro-N'-(6-chloro-1,3-benzothiazol-2-yl)ethanimidamide (PubChem CID 174165572) has the molecular formula C9H5Cl4N3S and a molecular weight of 329.04 g/mol. Its IUPAC name is 2,2,2-trichloro-N'-(6-chloro-1,3-benzothiazol-2-yl)ethanimidamide.
| Compound Name | 2,2,2-trichloro-N'-(6-chloro-1,3-benzothiazol-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 174165572 |
| Molecular Formula | C9H5Cl4N3S |
| Molecular Weight | 329.04 g/mol |
| Exact Mass | 326.90 |
| IUPAC Name | 2,2,2-trichloro-N'-(6-chloro-1,3-benzothiazol-2-yl)ethanimidamide |
| SMILES | NC(=Nc1nc2ccc(Cl)cc2s1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H5Cl4N3S/c10-4-1-2-5-6(3-4)17-8(15-5)16-7(14)9(11,12)13/h1-3H,(H2,14,15,16) |
| InChIKey | FEESVAHMISUXIV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.04 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|