C11H10BrCl2N3S — CID 174165578
N'-(6-bromo-1,3-benzothiazol-2-yl)-2,2-dichlorobutanimidamide (PubChem CID 174165578) has the molecular formula C11H10BrCl2N3S and a molecular weight of 367.10 g/mol. Its IUPAC name is N'-(6-bromo-1,3-benzothiazol-2-yl)-2,2-dichlorobutanimidamide.
| Compound Name | N'-(6-bromo-1,3-benzothiazol-2-yl)-2,2-dichlorobutanimidamide |
|---|---|
| PubChem CID | 174165578 |
| Molecular Formula | C11H10BrCl2N3S |
| Molecular Weight | 367.10 g/mol |
| Exact Mass | 364.92 |
| IUPAC Name | N'-(6-bromo-1,3-benzothiazol-2-yl)-2,2-dichlorobutanimidamide |
| SMILES | CCC(Cl)(Cl)C(N)=Nc1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C11H10BrCl2N3S/c1-2-11(13,14)9(15)17-10-16-7-4-3-6(12)5-8(7)18-10/h3-5H,2H2,1H3,(H2,15,16,17) |
| InChIKey | NXCOKIRPJMRGLY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.10 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|