C15H14BrIN2S — CID 102552437
6-bromo-2-(1-propylpyridin-1-ium-4-yl)-1,3-benzothiazole iodide (PubChem CID 102552437) has the molecular formula C15H14BrIN2S and a molecular weight of 461.17 g/mol. Its IUPAC name is 6-bromo-2-(1-propylpyridin-1-ium-4-yl)-1,3-benzothiazole iodide.
| Compound Name | 6-bromo-2-(1-propylpyridin-1-ium-4-yl)-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 102552437 |
| Molecular Formula | C15H14BrIN2S |
| Molecular Weight | 461.17 g/mol |
| Exact Mass | 459.91 |
| IUPAC Name | 6-bromo-2-(1-propylpyridin-1-ium-4-yl)-1,3-benzothiazole iodide |
| SMILES | CCC[n+]1ccc(-c2nc3ccc(Br)cc3s2)cc1.[I-] |
| InChI | InChI=1S/C15H14BrN2S.HI/c1-2-7-18-8-5-11(6-9-18)15-17-13-4-3-12(16)10-14(13)19-15;/h3-6,8-10H,2,7H2,1H3;1H/q+1;/p-1 |
| InChIKey | OWCCXAGBTCOAMD-UHFFFAOYSA-M |
| XLogP | 1.43 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|