C15H15BrN2S — CID 67438719
6-bromo-2-phenyl-1,3-benzothiazole;N-methylmethanamine (PubChem CID 67438719) has the molecular formula C15H15BrN2S and a molecular weight of 335.27 g/mol. Its IUPAC name is 6-bromo-2-phenyl-1,3-benzothiazole;N-methylmethanamine.
| Compound Name | 6-bromo-2-phenyl-1,3-benzothiazole;N-methylmethanamine |
|---|---|
| PubChem CID | 67438719 |
| Molecular Formula | C15H15BrN2S |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 6-bromo-2-phenyl-1,3-benzothiazole;N-methylmethanamine |
| SMILES | Brc1ccc2nc(-c3ccccc3)sc2c1.CNC |
| InChI | InChI=1S/C13H8BrNS.C2H7N/c14-10-6-7-11-12(8-10)16-13(15-11)9-4-2-1-3-5-9;1-3-2/h1-8H;3H,1-2H3 |
| InChIKey | LLVQNSUHVSBUPE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |