C13H10BNO2S — CID 131531853
(2-phenyl-1,3-benzothiazol-6-yl)boronic acid (PubChem CID 131531853) has the molecular formula C13H10BNO2S and a molecular weight of 255.11 g/mol. Its IUPAC name is (2-phenyl-1,3-benzothiazol-6-yl)boronic acid.
| Compound Name | (2-phenyl-1,3-benzothiazol-6-yl)boronic acid |
|---|---|
| PubChem CID | 131531853 |
| Molecular Formula | C13H10BNO2S |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | (2-phenyl-1,3-benzothiazol-6-yl)boronic acid |
| SMILES | OB(O)c1ccc2nc(-c3ccccc3)sc2c1 |
| InChI | InChI=1S/C13H10BNO2S/c16-14(17)10-6-7-11-12(8-10)18-13(15-11)9-4-2-1-3-5-9/h1-8,16-17H |
| InChIKey | GBTINMMGXJHOGZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|