C13H10BrN2S+ — CID 100817889
6-bromo-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzothiazole (PubChem CID 100817889) has the molecular formula C13H10BrN2S+ and a molecular weight of 306.21 g/mol. Its IUPAC name is 6-bromo-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzothiazole.
| Compound Name | 6-bromo-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 100817889 |
| Molecular Formula | C13H10BrN2S+ |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 6-bromo-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzothiazole |
| SMILES | C[n+]1ccc(-c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C13H10BrN2S/c1-16-6-4-9(5-7-16)13-15-11-3-2-10(14)8-12(11)17-13/h2-8H,1H3/q+1 |
| InChIKey | VGQFLQAVGXVNEP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|