C13H9BrClN2S+ — CID 100817920
2-(5-bromo-1-methylpyridin-1-ium-3-yl)-6-chloro-1,3-benzothiazole (PubChem CID 100817920) has the molecular formula C13H9BrClN2S+ and a molecular weight of 340.65 g/mol. Its IUPAC name is 2-(5-bromo-1-methylpyridin-1-ium-3-yl)-6-chloro-1,3-benzothiazole.
| Compound Name | 2-(5-bromo-1-methylpyridin-1-ium-3-yl)-6-chloro-1,3-benzothiazole |
|---|---|
| PubChem CID | 100817920 |
| Molecular Formula | C13H9BrClN2S+ |
| Molecular Weight | 340.65 g/mol |
| Exact Mass | 338.94 |
| IUPAC Name | 2-(5-bromo-1-methylpyridin-1-ium-3-yl)-6-chloro-1,3-benzothiazole |
| SMILES | C[n+]1cc(Br)cc(-c2nc3ccc(Cl)cc3s2)c1 |
| InChI | InChI=1S/C13H9BrClN2S/c1-17-6-8(4-9(14)7-17)13-16-11-3-2-10(15)5-12(11)18-13/h2-7H,1H3/q+1 |
| InChIKey | QROWJKKTXLJOFJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.65 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|