C14H11ClN2OS — CID 79527850
5-(6-chloro-1,3-benzothiazol-2-yl)-2-methoxyaniline (PubChem CID 79527850) has the molecular formula C14H11ClN2OS and a molecular weight of 290.78 g/mol. Its IUPAC name is 5-(6-chloro-1,3-benzothiazol-2-yl)-2-methoxyaniline.
| Compound Name | 5-(6-chloro-1,3-benzothiazol-2-yl)-2-methoxyaniline |
|---|---|
| PubChem CID | 79527850 |
| Molecular Formula | C14H11ClN2OS |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 5-(6-chloro-1,3-benzothiazol-2-yl)-2-methoxyaniline |
| SMILES | COc1ccc(-c2nc3ccc(Cl)cc3s2)cc1N |
| InChI | InChI=1S/C14H11ClN2OS/c1-18-12-5-2-8(6-10(12)16)14-17-11-4-3-9(15)7-13(11)19-14/h2-7H,16H2,1H3 |
| InChIKey | HNSOVMSRVJEFFD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|