C14H9ClFNS — CID 102236319
6-chloro-2-(2-fluoro-5-methylphenyl)-1,3-benzothiazole (PubChem CID 102236319) has the molecular formula C14H9ClFNS and a molecular weight of 277.75 g/mol. Its IUPAC name is 6-chloro-2-(2-fluoro-5-methylphenyl)-1,3-benzothiazole.
| Compound Name | 6-chloro-2-(2-fluoro-5-methylphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 102236319 |
| Molecular Formula | C14H9ClFNS |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 6-chloro-2-(2-fluoro-5-methylphenyl)-1,3-benzothiazole |
| SMILES | Cc1ccc(F)c(-c2nc3ccc(Cl)cc3s2)c1 |
| InChI | InChI=1S/C14H9ClFNS/c1-8-2-4-11(16)10(6-8)14-17-12-5-3-9(15)7-13(12)18-14/h2-7H,1H3 |
| InChIKey | YUXGMFZHIRHFND-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |