C14H8BrNOS — CID 95930219
2-(4-bromophenyl)-1,3-benzothiazole-6-carbaldehyde (PubChem CID 95930219) has the molecular formula C14H8BrNOS and a molecular weight of 318.20 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1,3-benzothiazole-6-carbaldehyde.
| Compound Name | 2-(4-bromophenyl)-1,3-benzothiazole-6-carbaldehyde |
|---|---|
| PubChem CID | 95930219 |
| Molecular Formula | C14H8BrNOS |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 2-(4-bromophenyl)-1,3-benzothiazole-6-carbaldehyde |
| SMILES | O=Cc1ccc2nc(-c3ccc(Br)cc3)sc2c1 |
| InChI | InChI=1S/C14H8BrNOS/c15-11-4-2-10(3-5-11)14-16-12-6-1-9(8-17)7-13(12)18-14/h1-8H |
| InChIKey | WGIMSPGQAHGSGU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|