C15H10F2N2OS — CID 144775740
2-[6-(1,1-difluoroethyl)-3-pyridinyl]-1,3-benzothiazole-6-carbaldehyde (PubChem CID 144775740) has the molecular formula C15H10F2N2OS and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-[6-(1,1-difluoroethyl)-3-pyridinyl]-1,3-benzothiazole-6-carbaldehyde.
| Compound Name | 2-[6-(1,1-difluoroethyl)-3-pyridinyl]-1,3-benzothiazole-6-carbaldehyde |
|---|---|
| PubChem CID | 144775740 |
| Molecular Formula | C15H10F2N2OS |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-[6-(1,1-difluoroethyl)-3-pyridinyl]-1,3-benzothiazole-6-carbaldehyde |
| SMILES | CC(F)(F)c1ccc(-c2nc3ccc(C=O)cc3s2)cn1 |
| InChI | InChI=1S/C15H10F2N2OS/c1-15(16,17)13-5-3-10(7-18-13)14-19-11-4-2-9(8-20)6-12(11)21-14/h2-8H,1H3 |
| InChIKey | BKGFSICDXLPHBQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|