C15H8F3NO2S — CID 122424122
2-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazole-5-carbaldehyde (PubChem CID 122424122) has the molecular formula C15H8F3NO2S and a molecular weight of 323.30 g/mol. Its IUPAC name is 2-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazole-5-carbaldehyde.
| Compound Name | 2-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 122424122 |
| Molecular Formula | C15H8F3NO2S |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazole-5-carbaldehyde |
| SMILES | O=Cc1ccc2sc(-c3ccc(OC(F)(F)F)cc3)nc2c1 |
| InChI | InChI=1S/C15H8F3NO2S/c16-15(17,18)21-11-4-2-10(3-5-11)14-19-12-7-9(8-20)1-6-13(12)22-14/h1-8H |
| InChIKey | CRLMIQSOGINZOO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|