C25H21F3N4OS2 — CID 155149862
1-[(E)-[2-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazol-5-yl]methylideneamino]-3-(2,4,6-trimethylphenyl)thiourea (PubChem CID 155149862) has the molecular formula C25H21F3N4OS2 and a molecular weight of 514.60 g/mol. Its IUPAC name is 1-[(E)-[2-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazol-5-yl]methylideneamino]-3-(2,4,6-trimethylphenyl)thiourea.
| Compound Name | 1-[(E)-[2-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazol-5-yl]methylideneamino]-3-(2,4,6-trimethylphenyl)thiourea |
|---|---|
| PubChem CID | 155149862 |
| Molecular Formula | C25H21F3N4OS2 |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 1-[(E)-[2-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazol-5-yl]methylideneamino]-3-(2,4,6-trimethylphenyl)thiourea |
| SMILES | Cc1cc(C)c(NC(=S)N/N=C/c2ccc3sc(-c4ccc(OC(F)(F)F)cc4)nc3c2)c(C)c1 |
| InChI | InChI=1S/C25H21F3N4OS2/c1-14-10-15(2)22(16(3)11-14)31-24(34)32-29-13-17-4-9-21-20(12-17)30-23(35-21)18-5-7-19(8-6-18)33-25(26,27)28/h4-13H,1-3H3,(H2,31,32,34)/b29-13+ |
| InChIKey | FIEZFRZGPSLJKQ-VFLNYLIXSA-N |
| XLogP | 7.11 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|