C18H13F3N4O2S — CID 138625427
1-ethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carbaldehyde (PubChem CID 138625427) has the molecular formula C18H13F3N4O2S and a molecular weight of 406.39 g/mol. Its IUPAC name is 1-ethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carbaldehyde.
| Compound Name | 1-ethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 138625427 |
| Molecular Formula | C18H13F3N4O2S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 1-ethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carbaldehyde |
| SMILES | CCn1c(Nc2nc3ccc(OC(F)(F)F)cc3s2)nc2cc(C=O)ccc21 |
| InChI | InChI=1S/C18H13F3N4O2S/c1-2-25-14-6-3-10(9-26)7-13(14)22-16(25)24-17-23-12-5-4-11(8-15(12)28-17)27-18(19,20)21/h3-9H,2H2,1H3,(H,22,23,24) |
| InChIKey | AJRUIHGOLRDPER-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|