C29H38F3N5O3S — CID 159190658
1-ethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylic acid;N-methyldecan-1-amine (PubChem CID 159190658) has the molecular formula C29H38F3N5O3S and a molecular weight of 593.72 g/mol. Its IUPAC name is 1-ethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylic acid;N-methyldecan-1-amine.
| Compound Name | 1-ethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylic acid;N-methyldecan-1-amine |
|---|---|
| PubChem CID | 159190658 |
| Molecular Formula | C29H38F3N5O3S |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | 1-ethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylic acid;N-methyldecan-1-amine |
| SMILES | CCCCCCCCCCNC.CCn1c(Nc2nc3ccc(OC(F)(F)F)cc3s2)nc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C18H13F3N4O3S.C11H25N/c1-2-25-13-6-3-9(15(26)27)7-12(13)22-16(25)24-17-23-11-5-4-10(8-14(11)29-17)28-18(19,20)21;1-3-4-5-6-7-8-9-10-11-12-2/h3-8H,2H2,1H3,(H,26,27)(H,22,23,24);12H,3-11H2,1-2H3 |
| InChIKey | KOAVOXKYHLJXPC-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|