C9H4Cl5N3S — CID 170692251
2,2,2-trichloro-N'-(4,6-dichloro-1,3-benzothiazol-2-yl)ethanimidamide (PubChem CID 170692251) has the molecular formula C9H4Cl5N3S and a molecular weight of 363.48 g/mol. Its IUPAC name is 2,2,2-trichloro-N'-(4,6-dichloro-1,3-benzothiazol-2-yl)ethanimidamide.
| Compound Name | 2,2,2-trichloro-N'-(4,6-dichloro-1,3-benzothiazol-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 170692251 |
| Molecular Formula | C9H4Cl5N3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 360.86 |
| IUPAC Name | 2,2,2-trichloro-N'-(4,6-dichloro-1,3-benzothiazol-2-yl)ethanimidamide |
| SMILES | N/C(=N\c1nc2c(Cl)cc(Cl)cc2s1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H4Cl5N3S/c10-3-1-4(11)6-5(2-3)18-8(16-6)17-7(15)9(12,13)14/h1-2H,(H2,15,16,17) |
| InChIKey | PRQBISUHOKACBA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|