About 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine
4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine (PubChem CID 102044948) has the molecular formula C13H10FN5S
and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine.
Molecular Properties
| Compound Name | 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine |
| PubChem CID | 102044948 |
| Molecular Formula | C13H10FN5S |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine |
| SMILES | Nc1ccc(/N=N/c2nc3ccc(F)cc3s2)c(N)c1 |
| InChI | InChI=1S/C13H10FN5S/c14-7-1-3-11-12(5-7)20-13(17-11)19-18-10-4-2-8(15)6-9(10)16/h1-6H,15-16H2/b19-18+ |
| InChIKey | YRIFFPRGECVZHJ-VHEBQXMUSA-N |
| XLogP | 4.02 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine?
The IUPAC name of 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine (CID 102044948) is 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine.
What is the SMILES notation for 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine?
The canonical SMILES for 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine is Nc1ccc(/N=N/c2nc3ccc(F)cc3s2)c(N)c1.
What is the InChIKey of 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine?
The InChIKey is YRIFFPRGECVZHJ-VHEBQXMUSA-N. The full InChI is InChI=1S/C13H10FN5S/c14-7-1-3-11-12(5-7)20-13(17-11)19-18-10-4-2-8(15)6-9(10)16/h1-6H,15-16H2/b19-18+.
What are the key properties of 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine?
4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine has a molecular weight of 287.32 g/mol, XLogP of 4.02, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine is sourced from PubChem (CID 102044948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).