C13H10FN5S — CID 102044948
4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine (PubChem CID 102044948) has the molecular formula C13H10FN5S and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine.
| Compound Name | 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 102044948 |
| Molecular Formula | C13H10FN5S |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-[(6-fluoro-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-diamine |
| SMILES | Nc1ccc(/N=N/c2nc3ccc(F)cc3s2)c(N)c1 |
| InChI | InChI=1S/C13H10FN5S/c14-7-1-3-11-12(5-7)20-13(17-11)19-18-10-4-2-8(15)6-9(10)16/h1-6H,15-16H2/b19-18+ |
| InChIKey | YRIFFPRGECVZHJ-VHEBQXMUSA-N |
| XLogP | 4.02 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|