C11H7FN4S — CID 79148122
3-(6-fluoro-1,3-benzothiazol-2-yl)pyrazin-2-amine (PubChem CID 79148122) has the molecular formula C11H7FN4S and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-(6-fluoro-1,3-benzothiazol-2-yl)pyrazin-2-amine.
| Compound Name | 3-(6-fluoro-1,3-benzothiazol-2-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 79148122 |
| Molecular Formula | C11H7FN4S |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 3-(6-fluoro-1,3-benzothiazol-2-yl)pyrazin-2-amine |
| SMILES | Nc1nccnc1-c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C11H7FN4S/c12-6-1-2-7-8(5-6)17-11(16-7)9-10(13)15-4-3-14-9/h1-5H,(H2,13,15) |
| InChIKey | NVEBMDSFLJIJPC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |