C13H8BrFN2S — CID 79148767
4-bromo-2-(6-fluoro-1,3-benzothiazol-2-yl)aniline (PubChem CID 79148767) has the molecular formula C13H8BrFN2S and a molecular weight of 323.19 g/mol. Its IUPAC name is 4-bromo-2-(6-fluoro-1,3-benzothiazol-2-yl)aniline.
| Compound Name | 4-bromo-2-(6-fluoro-1,3-benzothiazol-2-yl)aniline |
|---|---|
| PubChem CID | 79148767 |
| Molecular Formula | C13H8BrFN2S |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 4-bromo-2-(6-fluoro-1,3-benzothiazol-2-yl)aniline |
| SMILES | Nc1ccc(Br)cc1-c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C13H8BrFN2S/c14-7-1-3-10(16)9(5-7)13-17-11-4-2-8(15)6-12(11)18-13/h1-6H,16H2 |
| InChIKey | ZLMRLXMPLRDPCA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|