C14H9FN2OS — CID 136862914
(NE)-N-[[2-(6-fluoro-1,3-benzothiazol-2-yl)phenyl]methylidene]hydroxylamine (PubChem CID 136862914) has the molecular formula C14H9FN2OS and a molecular weight of 272.30 g/mol. Its IUPAC name is (NE)-N-[[2-(6-fluoro-1,3-benzothiazol-2-yl)phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[2-(6-fluoro-1,3-benzothiazol-2-yl)phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 136862914 |
| Molecular Formula | C14H9FN2OS |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | (NE)-N-[[2-(6-fluoro-1,3-benzothiazol-2-yl)phenyl]methylidene]hydroxylamine |
| SMILES | O/N=C/c1ccccc1-c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C14H9FN2OS/c15-10-5-6-12-13(7-10)19-14(17-12)11-4-2-1-3-9(11)8-16-18/h1-8,18H/b16-8+ |
| InChIKey | JQKMRZXIOJRLHM-LZYBPNLTSA-N |
| XLogP | 3.91 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|