C7H5F2NO — CID 53395027
N-[(2,4-difluorophenyl)methylidene]hydroxylamine (PubChem CID 53395027) has the molecular formula C7H5F2NO and a molecular weight of 157.12 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methylidene]hydroxylamine.
| Compound Name | N-[(2,4-difluorophenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 53395027 |
| Molecular Formula | C7H5F2NO |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | N-[(2,4-difluorophenyl)methylidene]hydroxylamine |
| SMILES | ON=Cc1ccc(F)cc1F |
| InChI | InChI=1S/C7H5F2NO/c8-6-2-1-5(4-10-11)7(9)3-6/h1-4,11H |
| InChIKey | SVCQIVUYSQKNAZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|