C7H3F4NO — CID 175024126
N-[(2,3,4,5-tetrafluorophenyl)methylidene]hydroxylamine (PubChem CID 175024126) has the molecular formula C7H3F4NO and a molecular weight of 193.10 g/mol. Its IUPAC name is N-[(2,3,4,5-tetrafluorophenyl)methylidene]hydroxylamine.
| Compound Name | N-[(2,3,4,5-tetrafluorophenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 175024126 |
| Molecular Formula | C7H3F4NO |
| Molecular Weight | 193.10 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | N-[(2,3,4,5-tetrafluorophenyl)methylidene]hydroxylamine |
| SMILES | ON=Cc1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7H3F4NO/c8-4-1-3(2-12-13)5(9)7(11)6(4)10/h1-2,13H |
| InChIKey | MYYGTHFSWLOSJD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.10 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|