About 1-(2,2-dibromoethenyl)-2,4-difluorobenzene
1-(2,2-dibromoethenyl)-2,4-difluorobenzene (PubChem CID 82363001) has the molecular formula C8H4Br2F2
and a molecular weight of 297.92 g/mol. Its IUPAC name is 1-(2,2-dibromoethenyl)-2,4-difluorobenzene.
Molecular Properties
| Compound Name | 1-(2,2-dibromoethenyl)-2,4-difluorobenzene |
| PubChem CID | 82363001 |
| Molecular Formula | C8H4Br2F2 |
| Molecular Weight | 297.92 g/mol |
| Exact Mass | 295.86 |
| IUPAC Name | 1-(2,2-dibromoethenyl)-2,4-difluorobenzene |
| SMILES | Fc1ccc(C=C(Br)Br)c(F)c1 |
| InChI | InChI=1S/C8H4Br2F2/c9-8(10)3-5-1-2-6(11)4-7(5)12/h1-4H |
| InChIKey | NPRHBPDKFFIYAR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.92 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2,2-dibromoethenyl)-2,4-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dibromoethenyl)-2,4-difluorobenzene?
The IUPAC name of 1-(2,2-dibromoethenyl)-2,4-difluorobenzene (CID 82363001) is 1-(2,2-dibromoethenyl)-2,4-difluorobenzene.
What is the SMILES notation for 1-(2,2-dibromoethenyl)-2,4-difluorobenzene?
The canonical SMILES for 1-(2,2-dibromoethenyl)-2,4-difluorobenzene is Fc1ccc(C=C(Br)Br)c(F)c1.
What is the InChIKey of 1-(2,2-dibromoethenyl)-2,4-difluorobenzene?
The InChIKey is NPRHBPDKFFIYAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Br2F2/c9-8(10)3-5-1-2-6(11)4-7(5)12/h1-4H.
What are the key properties of 1-(2,2-dibromoethenyl)-2,4-difluorobenzene?
1-(2,2-dibromoethenyl)-2,4-difluorobenzene has a molecular weight of 297.92 g/mol, XLogP of 4.05, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dibromoethenyl)-2,4-difluorobenzene is sourced from PubChem (CID 82363001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).