C9H8Br2FNO2S — CID 135186418
N-[2-(2,2-dibromoethenyl)-5-fluorophenyl]methanesulfonamide (PubChem CID 135186418) has the molecular formula C9H8Br2FNO2S and a molecular weight of 373.04 g/mol. Its IUPAC name is N-[2-(2,2-dibromoethenyl)-5-fluorophenyl]methanesulfonamide.
| Compound Name | N-[2-(2,2-dibromoethenyl)-5-fluorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 135186418 |
| Molecular Formula | C9H8Br2FNO2S |
| Molecular Weight | 373.04 g/mol |
| Exact Mass | 370.86 |
| IUPAC Name | N-[2-(2,2-dibromoethenyl)-5-fluorophenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(F)ccc1C=C(Br)Br |
| InChI | InChI=1S/C9H8Br2FNO2S/c1-16(14,15)13-8-5-7(12)3-2-6(8)4-9(10)11/h2-5,13H,1H3 |
| InChIKey | QLYYXJLYNDOPEU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.04 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |