C9H7Br2F — CID 130531997
2-(2,2-dibromoethenyl)-4-fluoro-1-methylbenzene (PubChem CID 130531997) has the molecular formula C9H7Br2F and a molecular weight of 293.96 g/mol. Its IUPAC name is 2-(2,2-dibromoethenyl)-4-fluoro-1-methylbenzene.
| Compound Name | 2-(2,2-dibromoethenyl)-4-fluoro-1-methylbenzene |
|---|---|
| PubChem CID | 130531997 |
| Molecular Formula | C9H7Br2F |
| Molecular Weight | 293.96 g/mol |
| Exact Mass | 291.89 |
| IUPAC Name | 2-(2,2-dibromoethenyl)-4-fluoro-1-methylbenzene |
| SMILES | Cc1ccc(F)cc1C=C(Br)Br |
| InChI | InChI=1S/C9H7Br2F/c1-6-2-3-8(12)4-7(6)5-9(10)11/h2-5H,1H3 |
| InChIKey | XAOYLISEPIWJHR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.96 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |