C16H15FN2S — CID 80556024
4-[2-(6-fluoro-1,3-benzothiazol-2-yl)propan-2-yl]aniline (PubChem CID 80556024) has the molecular formula C16H15FN2S and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-[2-(6-fluoro-1,3-benzothiazol-2-yl)propan-2-yl]aniline.
| Compound Name | 4-[2-(6-fluoro-1,3-benzothiazol-2-yl)propan-2-yl]aniline |
|---|---|
| PubChem CID | 80556024 |
| Molecular Formula | C16H15FN2S |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 4-[2-(6-fluoro-1,3-benzothiazol-2-yl)propan-2-yl]aniline |
| SMILES | CC(C)(c1ccc(N)cc1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C16H15FN2S/c1-16(2,10-3-6-12(18)7-4-10)15-19-13-8-5-11(17)9-14(13)20-15/h3-9H,18H2,1-2H3 |
| InChIKey | YALSJIDVLISNCJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|