C14H11FN2OS — CID 79148962
3-[(6-fluoro-1,3-benzothiazol-2-yl)methoxy]aniline (PubChem CID 79148962) has the molecular formula C14H11FN2OS and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-[(6-fluoro-1,3-benzothiazol-2-yl)methoxy]aniline.
| Compound Name | 3-[(6-fluoro-1,3-benzothiazol-2-yl)methoxy]aniline |
|---|---|
| PubChem CID | 79148962 |
| Molecular Formula | C14H11FN2OS |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3-[(6-fluoro-1,3-benzothiazol-2-yl)methoxy]aniline |
| SMILES | Nc1cccc(OCc2nc3ccc(F)cc3s2)c1 |
| InChI | InChI=1S/C14H11FN2OS/c15-9-4-5-12-13(6-9)19-14(17-12)8-18-11-3-1-2-10(16)7-11/h1-7H,8,16H2 |
| InChIKey | JQVVOFDDXYXORV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|