About 3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline
3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline (PubChem CID 65336796) has the molecular formula C13H11N3OS
and a molecular weight of 257.32 g/mol. Its IUPAC name is 3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline.
Molecular Properties
| Compound Name | 3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline |
| PubChem CID | 65336796 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline |
| SMILES | Nc1cccc(OCc2nc3cccnc3s2)c1 |
| InChI | InChI=1S/C13H11N3OS/c14-9-3-1-4-10(7-9)17-8-12-16-11-5-2-6-15-13(11)18-12/h1-7H,8,14H2 |
| InChIKey | HLYZSVOXQQESHE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline?
The IUPAC name of 3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline (CID 65336796) is 3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline.
What is the SMILES notation for 3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline?
The canonical SMILES for 3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline is Nc1cccc(OCc2nc3cccnc3s2)c1.
What is the InChIKey of 3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline?
The InChIKey is HLYZSVOXQQESHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3OS/c14-9-3-1-4-10(7-9)17-8-12-16-11-5-2-6-15-13(11)18-12/h1-7H,8,14H2.
What are the key properties of 3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline?
3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline has a molecular weight of 257.32 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-([1,3]thiazolo[5,4-b]pyridin-2-ylmethoxy)aniline is sourced from PubChem (CID 65336796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).