C13H11N3OS — CID 113305036
4-methoxy-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline (PubChem CID 113305036) has the molecular formula C13H11N3OS and a molecular weight of 257.32 g/mol. Its IUPAC name is 4-methoxy-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline.
| Compound Name | 4-methoxy-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline |
|---|---|
| PubChem CID | 113305036 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 4-methoxy-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline |
| SMILES | COc1ccc(N)c(-c2nc3cccnc3s2)c1 |
| InChI | InChI=1S/C13H11N3OS/c1-17-8-4-5-10(14)9(7-8)12-16-11-3-2-6-15-13(11)18-12/h2-7H,14H2,1H3 |
| InChIKey | MZSOUCNWLSQSMP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|