C12H8N2O2S — CID 136927565
2-([1,3]thiazolo[5,4-b]pyridin-2-yl)benzene-1,4-diol (PubChem CID 136927565) has the molecular formula C12H8N2O2S and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-([1,3]thiazolo[5,4-b]pyridin-2-yl)benzene-1,4-diol.
| Compound Name | 2-([1,3]thiazolo[5,4-b]pyridin-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 136927565 |
| Molecular Formula | C12H8N2O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 2-([1,3]thiazolo[5,4-b]pyridin-2-yl)benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(-c2nc3cccnc3s2)c1 |
| InChI | InChI=1S/C12H8N2O2S/c15-7-3-4-10(16)8(6-7)11-14-9-2-1-5-13-12(9)17-11/h1-6,15-16H |
| InChIKey | RFTDCTGTJAWGEJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|