C9H12N2SSn — CID 143914856
trimethyl([1,3]thiazolo[5,4-b]pyridin-2-yl)stannane (PubChem CID 143914856) has the molecular formula C9H12N2SSn and a molecular weight of 298.99 g/mol. Its IUPAC name is trimethyl([1,3]thiazolo[5,4-b]pyridin-2-yl)stannane.
| Compound Name | trimethyl([1,3]thiazolo[5,4-b]pyridin-2-yl)stannane |
|---|---|
| PubChem CID | 143914856 |
| Molecular Formula | C9H12N2SSn |
| Molecular Weight | 298.99 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | trimethyl([1,3]thiazolo[5,4-b]pyridin-2-yl)stannane |
| SMILES | C[Sn](C)(C)c1nc2cccnc2s1 |
| InChI | InChI=1S/C6H3N2S.3CH3.Sn/c1-2-5-6(7-3-1)9-4-8-5;;;;/h1-3H;3*1H3; |
| InChIKey | GOGBSVNTUNZIPH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.99 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |